C17H14F5N2O+ — CID 90780176
1,2,3-trimethyl-8-[(2,3,4,5,6-pentafluorophenyl)methoxy]imidazo[1,2-a]pyridin-1-ium (PubChem CID 90780176) has the molecular formula C17H14F5N2O+ and a molecular weight of 357.30 g/mol. Its IUPAC name is 1,2,3-trimethyl-8-[(2,3,4,5,6-pentafluorophenyl)methoxy]imidazo[1,2-a]pyridin-1-ium.
| Compound Name | 1,2,3-trimethyl-8-[(2,3,4,5,6-pentafluorophenyl)methoxy]imidazo[1,2-a]pyridin-1-ium |
|---|---|
| PubChem CID | 90780176 |
| Molecular Formula | C17H14F5N2O+ |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 1,2,3-trimethyl-8-[(2,3,4,5,6-pentafluorophenyl)methoxy]imidazo[1,2-a]pyridin-1-ium |
| SMILES | Cc1c(C)[n+](C)c2c(OCc3c(F)c(F)c(F)c(F)c3F)cccn12 |
| InChI | InChI=1S/C17H14F5N2O/c1-8-9(2)24-6-4-5-11(17(24)23(8)3)25-7-10-12(18)14(20)16(22)15(21)13(10)19/h4-6H,7H2,1-3H3/q+1 |
| InChIKey | LTGCSYKCGWHVGZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 17.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|