C26H22ClN3O2 — CID 13075834
2-[3-benzyl-5-chloro-2-(3-methoxy-4-phenylmethoxyphenyl)imidazol-4-yl]acetonitrile (PubChem CID 13075834) has the molecular formula C26H22ClN3O2 and a molecular weight of 443.93 g/mol. Its IUPAC name is 2-[3-benzyl-5-chloro-2-(3-methoxy-4-phenylmethoxyphenyl)imidazol-4-yl]acetonitrile.
| Compound Name | 2-[3-benzyl-5-chloro-2-(3-methoxy-4-phenylmethoxyphenyl)imidazol-4-yl]acetonitrile |
|---|---|
| PubChem CID | 13075834 |
| Molecular Formula | C26H22ClN3O2 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-[3-benzyl-5-chloro-2-(3-methoxy-4-phenylmethoxyphenyl)imidazol-4-yl]acetonitrile |
| SMILES | COc1cc(-c2nc(Cl)c(CC#N)n2Cc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H22ClN3O2/c1-31-24-16-21(12-13-23(24)32-18-20-10-6-3-7-11-20)26-29-25(27)22(14-15-28)30(26)17-19-8-4-2-5-9-19/h2-13,16H,14,17-18H2,1H3 |
| InChIKey | XXAWDJIUQRSJEQ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |