C19H19FN6O — CID 156637211
N-[2-(3-ethoxyphenyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]-N'-fluoro-N'-methylmethanediamine (PubChem CID 156637211) has the molecular formula C19H19FN6O and a molecular weight of 366.40 g/mol. Its IUPAC name is N-[2-(3-ethoxyphenyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]-N'-fluoro-N'-methylmethanediamine.
| Compound Name | N-[2-(3-ethoxyphenyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]-N'-fluoro-N'-methylmethanediamine |
|---|---|
| PubChem CID | 156637211 |
| Molecular Formula | C19H19FN6O |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-[2-(3-ethoxyphenyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]-N'-fluoro-N'-methylmethanediamine |
| SMILES | CCOc1cccc(-c2nc3c4ccccc4nc(NCN(C)F)n3n2)c1 |
| InChI | InChI=1S/C19H19FN6O/c1-3-27-14-8-6-7-13(11-14)17-23-18-15-9-4-5-10-16(15)22-19(26(18)24-17)21-12-25(2)20/h4-11H,3,12H2,1-2H3,(H,21,22) |
| InChIKey | LJGAMIACJQFYLI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|