C21H23N5O2 — CID 20880428
N-butyl-8,9-dimethoxy-2-phenyl-[1,2,4]triazolo[1,5-c]quinazolin-5-amine (PubChem CID 20880428) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-butyl-8,9-dimethoxy-2-phenyl-[1,2,4]triazolo[1,5-c]quinazolin-5-amine.
| Compound Name | N-butyl-8,9-dimethoxy-2-phenyl-[1,2,4]triazolo[1,5-c]quinazolin-5-amine |
|---|---|
| PubChem CID | 20880428 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-butyl-8,9-dimethoxy-2-phenyl-[1,2,4]triazolo[1,5-c]quinazolin-5-amine |
| SMILES | CCCCNc1nc2cc(OC)c(OC)cc2c2nc(-c3ccccc3)nn12 |
| InChI | InChI=1S/C21H23N5O2/c1-4-5-11-22-21-23-16-13-18(28-3)17(27-2)12-15(16)20-24-19(25-26(20)21)14-9-7-6-8-10-14/h6-10,12-13H,4-5,11H2,1-3H3,(H,22,23) |
| InChIKey | KTVMSQJHEYORNS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|