C25H31N7O2 — CID 20880462
N-[2-(2,6-dimethylpiperidin-1-yl)ethyl]-8,9-dimethoxy-2-pyridin-3-yl-[1,2,4]triazolo[1,5-c]quinazolin-5-amine (PubChem CID 20880462) has the molecular formula C25H31N7O2 and a molecular weight of 461.57 g/mol. Its IUPAC name is N-[2-(2,6-dimethylpiperidin-1-yl)ethyl]-8,9-dimethoxy-2-pyridin-3-yl-[1,2,4]triazolo[1,5-c]quinazolin-5-amine.
| Compound Name | N-[2-(2,6-dimethylpiperidin-1-yl)ethyl]-8,9-dimethoxy-2-pyridin-3-yl-[1,2,4]triazolo[1,5-c]quinazolin-5-amine |
|---|---|
| PubChem CID | 20880462 |
| Molecular Formula | C25H31N7O2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | N-[2-(2,6-dimethylpiperidin-1-yl)ethyl]-8,9-dimethoxy-2-pyridin-3-yl-[1,2,4]triazolo[1,5-c]quinazolin-5-amine |
| SMILES | COc1cc2nc(NCCN3C(C)CCCC3C)n3nc(-c4cccnc4)nc3c2cc1OC |
| InChI | InChI=1S/C25H31N7O2/c1-16-7-5-8-17(2)31(16)12-11-27-25-28-20-14-22(34-4)21(33-3)13-19(20)24-29-23(30-32(24)25)18-9-6-10-26-15-18/h6,9-10,13-17H,5,7-8,11-12H2,1-4H3,(H,27,28) |
| InChIKey | SNGIXAPKVCNPGP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |