C18H33NO — CID 156639075
ethane;3-[5-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-5-methylpyrrolidin-3-yl]propan-1-ol (PubChem CID 156639075) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is ethane;3-[5-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-5-methylpyrrolidin-3-yl]propan-1-ol.
| Compound Name | ethane;3-[5-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-5-methylpyrrolidin-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 156639075 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | ethane;3-[5-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-5-methylpyrrolidin-3-yl]propan-1-ol |
| SMILES | C=C/C(=C\C=C/C)CC1(C)CC(CCCO)CN1.CC |
| InChI | InChI=1S/C16H27NO.C2H6/c1-4-6-8-14(5-2)11-16(3)12-15(13-17-16)9-7-10-18;1-2/h4-6,8,15,17-18H,2,7,9-13H2,1,3H3;1-2H3/b6-4-,14-8+; |
| InChIKey | RWVYALBBIQEEQB-VQBJHNTESA-N |
| XLogP | 4.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|