C19H35NO — CID 174760806
11-[(1-ethylcyclohexa-2,4-dien-1-yl)amino]undecan-1-ol (PubChem CID 174760806) has the molecular formula C19H35NO and a molecular weight of 293.50 g/mol. Its IUPAC name is 11-[(1-ethylcyclohexa-2,4-dien-1-yl)amino]undecan-1-ol.
| Compound Name | 11-[(1-ethylcyclohexa-2,4-dien-1-yl)amino]undecan-1-ol |
|---|---|
| PubChem CID | 174760806 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | 11-[(1-ethylcyclohexa-2,4-dien-1-yl)amino]undecan-1-ol |
| SMILES | CCC1(NCCCCCCCCCCCO)C=CC=CC1 |
| InChI | InChI=1S/C19H35NO/c1-2-19(15-11-10-12-16-19)20-17-13-8-6-4-3-5-7-9-14-18-21/h10-12,15,20-21H,2-9,13-14,16-18H2,1H3 |
| InChIKey | ROZVXRRFOUOXOW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|