C10H17NO — CID 91512978
2-[1-(ethylamino)cyclohexa-2,4-dien-1-yl]ethanol (PubChem CID 91512978) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-[1-(ethylamino)cyclohexa-2,4-dien-1-yl]ethanol.
| Compound Name | 2-[1-(ethylamino)cyclohexa-2,4-dien-1-yl]ethanol |
|---|---|
| PubChem CID | 91512978 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-[1-(ethylamino)cyclohexa-2,4-dien-1-yl]ethanol |
| SMILES | CCNC1(CCO)C=CC=CC1 |
| InChI | InChI=1S/C10H17NO/c1-2-11-10(8-9-12)6-4-3-5-7-10/h3-6,11-12H,2,7-9H2,1H3 |
| InChIKey | CZINNYDWQHKNNE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |