About 2-ethylbutyl hexanoate;formaldehyde
2-ethylbutyl hexanoate;formaldehyde (PubChem CID 156639908) has the molecular formula C13H26O3
and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-ethylbutyl hexanoate;formaldehyde.
Molecular Properties
| Compound Name | 2-ethylbutyl hexanoate;formaldehyde |
| PubChem CID | 156639908 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 2-ethylbutyl hexanoate;formaldehyde |
| SMILES | C=O.CCCCCC(=O)OCC(CC)CC |
| InChI | InChI=1S/C12H24O2.CH2O/c1-4-7-8-9-12(13)14-10-11(5-2)6-3;1-2/h11H,4-10H2,1-3H3;1H2 |
| InChIKey | VJSYSMCOYZBVDQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylbutyl hexanoate;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylbutyl hexanoate;formaldehyde?
The IUPAC name of 2-ethylbutyl hexanoate;formaldehyde (CID 156639908) is 2-ethylbutyl hexanoate;formaldehyde.
What is the SMILES notation for 2-ethylbutyl hexanoate;formaldehyde?
The canonical SMILES for 2-ethylbutyl hexanoate;formaldehyde is C=O.CCCCCC(=O)OCC(CC)CC.
What is the InChIKey of 2-ethylbutyl hexanoate;formaldehyde?
The InChIKey is VJSYSMCOYZBVDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2.CH2O/c1-4-7-8-9-12(13)14-10-11(5-2)6-3;1-2/h11H,4-10H2,1-3H3;1H2.
What are the key properties of 2-ethylbutyl hexanoate;formaldehyde?
2-ethylbutyl hexanoate;formaldehyde has a molecular weight of 230.35 g/mol, XLogP of 3.36, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylbutyl hexanoate;formaldehyde is sourced from PubChem (CID 156639908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).