C27H34N8O2 — CID 156640824
(3-amino-4-hydrazinylphenyl)-[4-[2-(3,5-dimethylanilino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-3-hydroxypiperidin-1-yl]methanone (PubChem CID 156640824) has the molecular formula C27H34N8O2 and a molecular weight of 502.62 g/mol. Its IUPAC name is (3-amino-4-hydrazinylphenyl)-[4-[2-(3,5-dimethylanilino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-3-hydroxypiperidin-1-yl]methanone.
| Compound Name | (3-amino-4-hydrazinylphenyl)-[4-[2-(3,5-dimethylanilino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-3-hydroxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 156640824 |
| Molecular Formula | C27H34N8O2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | (3-amino-4-hydrazinylphenyl)-[4-[2-(3,5-dimethylanilino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-3-hydroxypiperidin-1-yl]methanone |
| SMILES | Cc1cc(C)cc(Nc2ncc3c(n2)CCN(C2CCN(C(=O)c4ccc(NN)c(N)c4)CC2O)C3)c1 |
| InChI | InChI=1S/C27H34N8O2/c1-16-9-17(2)11-20(10-16)31-27-30-13-19-14-34(7-5-22(19)32-27)24-6-8-35(15-25(24)36)26(37)18-3-4-23(33-29)21(28)12-18/h3-4,9-13,24-25,33,36H,5-8,14-15,28-29H2,1-2H3,(H,30,31,32) |
| InChIKey | KXLDMNGHEWWNRB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|