C14H16F4N2O — CID 156641321
ethane;1-(3-fluoro-4-methoxy-2-methylphenyl)-3-(trifluoromethyl)pyrazole (PubChem CID 156641321) has the molecular formula C14H16F4N2O and a molecular weight of 304.29 g/mol. Its IUPAC name is ethane;1-(3-fluoro-4-methoxy-2-methylphenyl)-3-(trifluoromethyl)pyrazole.
| Compound Name | ethane;1-(3-fluoro-4-methoxy-2-methylphenyl)-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 156641321 |
| Molecular Formula | C14H16F4N2O |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | ethane;1-(3-fluoro-4-methoxy-2-methylphenyl)-3-(trifluoromethyl)pyrazole |
| SMILES | CC.COc1ccc(-n2ccc(C(F)(F)F)n2)c(C)c1F |
| InChI | InChI=1S/C12H10F4N2O.C2H6/c1-7-8(3-4-9(19-2)11(7)13)18-6-5-10(17-18)12(14,15)16;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | RFARWWBUQIJCEU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |