About 4-[[3-(3-fluorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]-1,2-dimethylpiperazine
4-[[3-(3-fluorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]-1,2-dimethylpiperazine (PubChem CID 70779659) has the molecular formula C23H27FN4O
and a molecular weight of 394.49 g/mol. Its IUPAC name is 4-[[3-(3-fluorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]-1,2-dimethylpiperazine.
Molecular Properties
| Compound Name | 4-[[3-(3-fluorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]-1,2-dimethylpiperazine |
| PubChem CID | 70779659 |
| Molecular Formula | C23H27FN4O |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 4-[[3-(3-fluorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]-1,2-dimethylpiperazine |
| SMILES | COc1ccc(-n2cc(CN3CCN(C)C(C)C3)c(-c3cccc(F)c3)n2)cc1 |
| InChI | InChI=1S/C23H27FN4O/c1-17-14-27(12-11-26(17)2)15-19-16-28(21-7-9-22(29-3)10-8-21)25-23(19)18-5-4-6-20(24)13-18/h4-10,13,16-17H,11-12,14-15H2,1-3H3 |
| InChIKey | WTDJZNXVYWNJNR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[3-(3-fluorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]-1,2-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-(3-fluorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]-1,2-dimethylpiperazine?
The IUPAC name of 4-[[3-(3-fluorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]-1,2-dimethylpiperazine (CID 70779659) is 4-[[3-(3-fluorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]-1,2-dimethylpiperazine.
What is the SMILES notation for 4-[[3-(3-fluorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]-1,2-dimethylpiperazine?
The canonical SMILES for 4-[[3-(3-fluorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]-1,2-dimethylpiperazine is COc1ccc(-n2cc(CN3CCN(C)C(C)C3)c(-c3cccc(F)c3)n2)cc1.
What is the InChIKey of 4-[[3-(3-fluorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]-1,2-dimethylpiperazine?
The InChIKey is WTDJZNXVYWNJNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27FN4O/c1-17-14-27(12-11-26(17)2)15-19-16-28(21-7-9-22(29-3)10-8-21)25-23(19)18-5-4-6-20(24)13-18/h4-10,13,16-17H,11-12,14-15H2,1-3H3.
What are the key properties of 4-[[3-(3-fluorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]-1,2-dimethylpiperazine?
4-[[3-(3-fluorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]-1,2-dimethylpiperazine has a molecular weight of 394.49 g/mol, XLogP of 3.82, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-(3-fluorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]-1,2-dimethylpiperazine is sourced from PubChem (CID 70779659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).