C5H8N5OPo — CID 156641933
CID 156641933 (PubChem CID 156641933) has the molecular formula C5H8N5OPo and a molecular weight of 363.15 g/mol.
| Compound Name | CID 156641933 |
|---|---|
| PubChem CID | 156641933 |
| Molecular Formula | C5H8N5OPo |
| Molecular Weight | 363.15 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | — |
| SMILES | O=C(C[Po])NCCc1nn[nH]n1 |
| InChI | InChI=1S/C5H8N5O.Po/c1-4(11)6-3-2-5-7-9-10-8-5;/h1-3H2,(H,6,11)(H,7,8,9,10); |
| InChIKey | VCBYCQLIPNOMKF-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.15 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |