C30H41F3N5O5P — CID 156642314
[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[3-[11-[4-(trifluoromethyl)phenyl]undec-10-ynoxy]propoxy]phosphinic acid (PubChem CID 156642314) has the molecular formula C30H41F3N5O5P and a molecular weight of 639.66 g/mol. Its IUPAC name is [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[3-[11-[4-(trifluoromethyl)phenyl]undec-10-ynoxy]propoxy]phosphinic acid.
| Compound Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[3-[11-[4-(trifluoromethyl)phenyl]undec-10-ynoxy]propoxy]phosphinic acid |
|---|---|
| PubChem CID | 156642314 |
| Molecular Formula | C30H41F3N5O5P |
| Molecular Weight | 639.66 g/mol |
| Exact Mass | 639.28 |
| IUPAC Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[3-[11-[4-(trifluoromethyl)phenyl]undec-10-ynoxy]propoxy]phosphinic acid |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(O)OCCCOCCCCCCCCCC#Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H41F3N5O5P/c1-24(20-38-22-37-27-28(34)35-21-36-29(27)38)42-23-44(39,40)43-19-11-18-41-17-10-8-6-4-2-3-5-7-9-12-25-13-15-26(16-14-25)30(31,32)33/h13-16,21-22,24H,2-8,10-11,17-20,23H2,1H3,(H,39,40)(H2,34,35,36)/t24-/m1/s1 |
| InChIKey | DYWWQVBJZRSHDS-XMMPIXPASA-N |
| XLogP | 6.57 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.66 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|