C28H50N5O5PSi — CID 165160397
[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[3-[10-[dimethyl(2-methylpropyl)silyl]dec-9-ynoxy]propoxy]phosphinic acid (PubChem CID 165160397) has the molecular formula C28H50N5O5PSi and a molecular weight of 595.80 g/mol. Its IUPAC name is [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[3-[10-[dimethyl(2-methylpropyl)silyl]dec-9-ynoxy]propoxy]phosphinic acid.
| Compound Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[3-[10-[dimethyl(2-methylpropyl)silyl]dec-9-ynoxy]propoxy]phosphinic acid |
|---|---|
| PubChem CID | 165160397 |
| Molecular Formula | C28H50N5O5PSi |
| Molecular Weight | 595.80 g/mol |
| Exact Mass | 595.33 |
| IUPAC Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[3-[10-[dimethyl(2-methylpropyl)silyl]dec-9-ynoxy]propoxy]phosphinic acid |
| SMILES | CC(C)C[Si](C)(C)C#CCCCCCCCCOCCCOP(=O)(O)CO[C@H](C)Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C28H50N5O5PSi/c1-24(2)20-40(4,5)18-13-11-9-7-6-8-10-12-15-36-16-14-17-38-39(34,35)23-37-25(3)19-33-22-32-26-27(29)30-21-31-28(26)33/h21-22,24-25H,6-12,14-17,19-20,23H2,1-5H3,(H,34,35)(H2,29,30,31)/t25-/m1/s1 |
| InChIKey | UCYYBMMXZIUGRJ-RUZDIDTESA-N |
| XLogP | 6.02 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.80 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|