C26H27NO — CID 156643832
N-[[3-(3-ethenyl-4-methylphenyl)-4-methylphenyl]methyl]-2-(3-methylphenyl)acetamide (PubChem CID 156643832) has the molecular formula C26H27NO and a molecular weight of 369.51 g/mol. Its IUPAC name is N-[[3-(3-ethenyl-4-methylphenyl)-4-methylphenyl]methyl]-2-(3-methylphenyl)acetamide.
| Compound Name | N-[[3-(3-ethenyl-4-methylphenyl)-4-methylphenyl]methyl]-2-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 156643832 |
| Molecular Formula | C26H27NO |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-[[3-(3-ethenyl-4-methylphenyl)-4-methylphenyl]methyl]-2-(3-methylphenyl)acetamide |
| SMILES | C=Cc1cc(-c2cc(CNC(=O)Cc3cccc(C)c3)ccc2C)ccc1C |
| InChI | InChI=1S/C26H27NO/c1-5-23-16-24(12-10-19(23)3)25-14-22(11-9-20(25)4)17-27-26(28)15-21-8-6-7-18(2)13-21/h5-14,16H,1,15,17H2,2-4H3,(H,27,28) |
| InChIKey | YFEWKPXCUXIBAI-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |