C13H16BrN7O — CID 156644177
2-[4-(4-amino-3-bromopyrazolo[3,4-d]pyrimidin-1-yl)cyclohexylidene]acetohydrazide (PubChem CID 156644177) has the molecular formula C13H16BrN7O and a molecular weight of 366.22 g/mol. Its IUPAC name is 2-[4-(4-amino-3-bromopyrazolo[3,4-d]pyrimidin-1-yl)cyclohexylidene]acetohydrazide.
| Compound Name | 2-[4-(4-amino-3-bromopyrazolo[3,4-d]pyrimidin-1-yl)cyclohexylidene]acetohydrazide |
|---|---|
| PubChem CID | 156644177 |
| Molecular Formula | C13H16BrN7O |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 2-[4-(4-amino-3-bromopyrazolo[3,4-d]pyrimidin-1-yl)cyclohexylidene]acetohydrazide |
| SMILES | NNC(=O)C=C1CCC(n2nc(Br)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C13H16BrN7O/c14-11-10-12(15)17-6-18-13(10)21(20-11)8-3-1-7(2-4-8)5-9(22)19-16/h5-6,8H,1-4,16H2,(H,19,22)(H2,15,17,18)/b7-5- |
| InChIKey | CKLABSRFQQVOAG-ALCCZGGFSA-N |
| XLogP | 1.20 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|