C37H46N6O7S — CID 156644325
benzyl N-[N'-[4-[2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-3-oxo-3-(1,3-thiazol-2-yl)propyl]cyclohexyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate (PubChem CID 156644325) has the molecular formula C37H46N6O7S and a molecular weight of 718.88 g/mol. Its IUPAC name is benzyl N-[N'-[4-[2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-3-oxo-3-(1,3-thiazol-2-yl)propyl]cyclohexyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate.
| Compound Name | benzyl N-[N'-[4-[2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-3-oxo-3-(1,3-thiazol-2-yl)propyl]cyclohexyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate |
|---|---|
| PubChem CID | 156644325 |
| Molecular Formula | C37H46N6O7S |
| Molecular Weight | 718.88 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | benzyl N-[N'-[4-[2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-3-oxo-3-(1,3-thiazol-2-yl)propyl]cyclohexyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate |
| SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)NC(CC1CCC(N=C(NC(=O)OCc2ccccc2)NC(=O)OCc2ccccc2)CC1)C(=O)c1nccs1 |
| InChI | InChI=1S/C37H46N6O7S/c1-24(2)20-31(39-25(3)44)33(46)41-30(32(45)34-38-18-19-51-34)21-26-14-16-29(17-15-26)40-35(42-36(47)49-22-27-10-6-4-7-11-27)43-37(48)50-23-28-12-8-5-9-13-28/h4-13,18-19,24,26,29-31H,14-17,20-23H2,1-3H3,(H,39,44)(H,41,46)(H2,40,42,43,47,48)/t26?,29?,30?,31-/m0/s1 |
| InChIKey | HHFZOOZIOQXQFW-DZIQYKJPSA-N |
| XLogP | 5.52 |
| TPSA | 177.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.88 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|