C22H28ClFN6O2 — CID 156645563
7-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[(2-methoxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidine (PubChem CID 156645563) has the molecular formula C22H28ClFN6O2 and a molecular weight of 462.96 g/mol. Its IUPAC name is 7-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[(2-methoxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidine.
| Compound Name | 7-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[(2-methoxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 156645563 |
| Molecular Formula | C22H28ClFN6O2 |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 7-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[(2-methoxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidine |
| SMILES | COC1CN2CCCC2(COc2nc(N3CC4CCC(C3)N4)c3cnc(Cl)c(F)c3n2)C1 |
| InChI | InChI=1S/C22H28ClFN6O2/c1-31-15-7-22(5-2-6-30(22)11-15)12-32-21-27-18-16(8-25-19(23)17(18)24)20(28-21)29-9-13-3-4-14(10-29)26-13/h8,13-15,26H,2-7,9-12H2,1H3 |
| InChIKey | NJEOKCNVORKZRE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|