C19H25ClFN5O — CID 156645658
7-chloro-N,N-diethyl-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-amine (PubChem CID 156645658) has the molecular formula C19H25ClFN5O and a molecular weight of 393.89 g/mol. Its IUPAC name is 7-chloro-N,N-diethyl-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | 7-chloro-N,N-diethyl-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 156645658 |
| Molecular Formula | C19H25ClFN5O |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 7-chloro-N,N-diethyl-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-amine |
| SMILES | CCN(CC)c1nc(OCC23CCCN2CCC3)nc2c(F)c(Cl)ncc12 |
| InChI | InChI=1S/C19H25ClFN5O/c1-3-25(4-2)17-13-11-22-16(20)14(21)15(13)23-18(24-17)27-12-19-7-5-9-26(19)10-6-8-19/h11H,3-10,12H2,1-2H3 |
| InChIKey | FPVIUARBVOYTSS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|