C18H27F — CID 156646039
but-1-ene;4-fluoro-1-methyl-2-[(Z)-4-methylhex-2-en-2-yl]benzene (PubChem CID 156646039) has the molecular formula C18H27F and a molecular weight of 262.41 g/mol. Its IUPAC name is but-1-ene;4-fluoro-1-methyl-2-[(Z)-4-methylhex-2-en-2-yl]benzene.
| Compound Name | but-1-ene;4-fluoro-1-methyl-2-[(Z)-4-methylhex-2-en-2-yl]benzene |
|---|---|
| PubChem CID | 156646039 |
| Molecular Formula | C18H27F |
| Molecular Weight | 262.41 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | but-1-ene;4-fluoro-1-methyl-2-[(Z)-4-methylhex-2-en-2-yl]benzene |
| SMILES | C=CCC.CCC(C)/C=C(/C)c1cc(F)ccc1C |
| InChI | InChI=1S/C14H19F.C4H8/c1-5-10(2)8-12(4)14-9-13(15)7-6-11(14)3;1-3-4-2/h6-10H,5H2,1-4H3;3H,1,4H2,2H3/b12-8-; |
| InChIKey | SWSFPDZNHSNHPK-JCTPKUEWSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.41 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|