C28H48O6 — CID 156647415
1,3-bis[(E)-1-[1-(1-methoxypropan-2-yloxy)propan-2-yloxy]prop-1-en-2-yl]benzene;ethane (PubChem CID 156647415) has the molecular formula C28H48O6 and a molecular weight of 480.69 g/mol. Its IUPAC name is 1,3-bis[(E)-1-[1-(1-methoxypropan-2-yloxy)propan-2-yloxy]prop-1-en-2-yl]benzene;ethane.
| Compound Name | 1,3-bis[(E)-1-[1-(1-methoxypropan-2-yloxy)propan-2-yloxy]prop-1-en-2-yl]benzene;ethane |
|---|---|
| PubChem CID | 156647415 |
| Molecular Formula | C28H48O6 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | 1,3-bis[(E)-1-[1-(1-methoxypropan-2-yloxy)propan-2-yloxy]prop-1-en-2-yl]benzene;ethane |
| SMILES | CC.COCC(C)OCC(C)O/C=C(\C)c1cccc(/C(C)=C/OC(C)COC(C)COC)c1 |
| InChI | InChI=1S/C26H42O6.C2H6/c1-19(13-29-23(5)17-31-21(3)15-27-7)25-10-9-11-26(12-25)20(2)14-30-24(6)18-32-22(4)16-28-8;1-2/h9-14,21-24H,15-18H2,1-8H3;1-2H3/b19-13+,20-14+; |
| InChIKey | DPBNAFZQIZYXLH-WKLZLTIDSA-N |
| XLogP | 6.35 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|