C18H28OS — CID 163241299
1-[(E)-but-2-en-2-yl]-3-[(E)-1-(2-methylpropoxy)prop-1-en-2-yl]benzene;methanethiol (PubChem CID 163241299) has the molecular formula C18H28OS and a molecular weight of 292.49 g/mol. Its IUPAC name is 1-[(E)-but-2-en-2-yl]-3-[(E)-1-(2-methylpropoxy)prop-1-en-2-yl]benzene;methanethiol.
| Compound Name | 1-[(E)-but-2-en-2-yl]-3-[(E)-1-(2-methylpropoxy)prop-1-en-2-yl]benzene;methanethiol |
|---|---|
| PubChem CID | 163241299 |
| Molecular Formula | C18H28OS |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 1-[(E)-but-2-en-2-yl]-3-[(E)-1-(2-methylpropoxy)prop-1-en-2-yl]benzene;methanethiol |
| SMILES | C/C=C(\C)c1cccc(/C(C)=C/OCC(C)C)c1.CS |
| InChI | InChI=1S/C17H24O.CH4S/c1-6-14(4)16-8-7-9-17(10-16)15(5)12-18-11-13(2)3;1-2/h6-10,12-13H,11H2,1-5H3;2H,1H3/b14-6+,15-12+; |
| InChIKey | XHAJHARLPRSQIV-PUILVDFSSA-N |
| XLogP | 5.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|