C15H21FN4O5S — CID 156647748
N-ethyl-2-[4-[(4-fluoro-5-formyl-1-methylpyrrol-3-yl)sulfonylamino]piperidin-1-yl]-2-oxoacetamide (PubChem CID 156647748) has the molecular formula C15H21FN4O5S and a molecular weight of 388.42 g/mol. Its IUPAC name is N-ethyl-2-[4-[(4-fluoro-5-formyl-1-methylpyrrol-3-yl)sulfonylamino]piperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-ethyl-2-[4-[(4-fluoro-5-formyl-1-methylpyrrol-3-yl)sulfonylamino]piperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 156647748 |
| Molecular Formula | C15H21FN4O5S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-ethyl-2-[4-[(4-fluoro-5-formyl-1-methylpyrrol-3-yl)sulfonylamino]piperidin-1-yl]-2-oxoacetamide |
| SMILES | CCNC(=O)C(=O)N1CCC(NS(=O)(=O)c2cn(C)c(C=O)c2F)CC1 |
| InChI | InChI=1S/C15H21FN4O5S/c1-3-17-14(22)15(23)20-6-4-10(5-7-20)18-26(24,25)12-8-19(2)11(9-21)13(12)16/h8-10,18H,3-7H2,1-2H3,(H,17,22) |
| InChIKey | RULUYKWADSMKBE-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|