C27H28N4O4 — CID 156648122
N-[7-(3-amino-3-methylbut-1-ynyl)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-4-[(3Z)-hexa-1,3,5-trien-2-yl]oxypyridine-2-carboxamide (PubChem CID 156648122) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is N-[7-(3-amino-3-methylbut-1-ynyl)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-4-[(3Z)-hexa-1,3,5-trien-2-yl]oxypyridine-2-carboxamide.
| Compound Name | N-[7-(3-amino-3-methylbut-1-ynyl)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-4-[(3Z)-hexa-1,3,5-trien-2-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 156648122 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | N-[7-(3-amino-3-methylbut-1-ynyl)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-4-[(3Z)-hexa-1,3,5-trien-2-yl]oxypyridine-2-carboxamide |
| SMILES | C=C/C=C\C(=C)Oc1ccnc(C(=O)NC2COc3ccc(C#CC(C)(C)N)cc3N(C)C2=O)c1 |
| InChI | InChI=1S/C27H28N4O4/c1-6-7-8-18(2)35-20-12-14-29-21(16-20)25(32)30-22-17-34-24-10-9-19(11-13-27(3,4)28)15-23(24)31(5)26(22)33/h6-10,12,14-16,22H,1-2,17,28H2,3-5H3,(H,30,32)/b8-7- |
| InChIKey | LCYHZBKMLIYIDJ-FPLPWBNLSA-N |
| XLogP | 2.96 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|