C27H23N3O11 — CID 156648236
N-[7-[2-(3-hydroxyoxetan-3-yl)ethynyl]-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-4-(2,3,4,5,6-pentahydroxyphenoxy)pyridine-2-carboxamide (PubChem CID 156648236) has the molecular formula C27H23N3O11 and a molecular weight of 565.49 g/mol. Its IUPAC name is N-[7-[2-(3-hydroxyoxetan-3-yl)ethynyl]-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-4-(2,3,4,5,6-pentahydroxyphenoxy)pyridine-2-carboxamide.
| Compound Name | N-[7-[2-(3-hydroxyoxetan-3-yl)ethynyl]-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-4-(2,3,4,5,6-pentahydroxyphenoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 156648236 |
| Molecular Formula | C27H23N3O11 |
| Molecular Weight | 565.49 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | N-[7-[2-(3-hydroxyoxetan-3-yl)ethynyl]-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-4-(2,3,4,5,6-pentahydroxyphenoxy)pyridine-2-carboxamide |
| SMILES | CN1C(=O)C(NC(=O)c2cc(Oc3c(O)c(O)c(O)c(O)c3O)ccn2)COc2ccc(C#CC3(O)COC3)cc21 |
| InChI | InChI=1S/C27H23N3O11/c1-30-17-8-13(4-6-27(38)11-39-12-27)2-3-18(17)40-10-16(26(30)37)29-25(36)15-9-14(5-7-28-15)41-24-22(34)20(32)19(31)21(33)23(24)35/h2-3,5,7-9,16,31-35,38H,10-12H2,1H3,(H,29,36) |
| InChIKey | VWUHDUIQMBAYNR-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 211.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.49 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|