C20H25FIN6OS- — CID 156649128
6-ethyl-N-[[3-fluoro-4-(4-methyliodanuidyl-5,6-dihydro-1,2,4-triazin-1-yl)phenyl]methyl]-2-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carboxamide (PubChem CID 156649128) has the molecular formula C20H25FIN6OS- and a molecular weight of 543.43 g/mol. Its IUPAC name is 6-ethyl-N-[[3-fluoro-4-(4-methyliodanuidyl-5,6-dihydro-1,2,4-triazin-1-yl)phenyl]methyl]-2-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carboxamide.
| Compound Name | 6-ethyl-N-[[3-fluoro-4-(4-methyliodanuidyl-5,6-dihydro-1,2,4-triazin-1-yl)phenyl]methyl]-2-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 156649128 |
| Molecular Formula | C20H25FIN6OS- |
| Molecular Weight | 543.43 g/mol |
| Exact Mass | 543.08 |
| IUPAC Name | 6-ethyl-N-[[3-fluoro-4-(4-methyliodanuidyl-5,6-dihydro-1,2,4-triazin-1-yl)phenyl]methyl]-2-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-carboxamide |
| SMILES | CCc1nc2n(c1C(=O)NCc1ccc(N3CCN([I-]C)C=N3)c(F)c1)CC(C)S2 |
| InChI | InChI=1S/C20H25FIN6OS/c1-4-16-18(27-11-13(2)30-20(27)25-16)19(29)23-10-14-5-6-17(15(21)9-14)28-8-7-26(22-3)12-24-28/h5-6,9,12-13H,4,7-8,10-11H2,1-3H3,(H,23,29)/q-1 |
| InChIKey | UYNBUXBOWMRHHM-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.43 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|