C23H24F4N6O3S — CID 165413743
2-ethyl-N-[[3-fluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]-6,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 165413743) has the molecular formula C23H24F4N6O3S and a molecular weight of 540.54 g/mol. Its IUPAC name is 2-ethyl-N-[[3-fluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]-6,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 2-ethyl-N-[[3-fluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]-6,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 165413743 |
| Molecular Formula | C23H24F4N6O3S |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 2-ethyl-N-[[3-fluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]-6,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCc1nc2cc(C)c(C)cn2c1C(=O)NCc1ccc(N2CCN(S(=O)(=O)C(F)(F)F)C=N2)c(F)c1 |
| InChI | InChI=1S/C23H24F4N6O3S/c1-4-18-21(32-12-15(3)14(2)9-20(32)30-18)22(34)28-11-16-5-6-19(17(24)10-16)33-8-7-31(13-29-33)37(35,36)23(25,26)27/h5-6,9-10,12-13H,4,7-8,11H2,1-3H3,(H,28,34) |
| InChIKey | ZHDVEHUEKPHKSM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |