C20H17ClF5N7O3S — CID 165413669
6-chloro-N-[[3,5-difluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyrimidine-3-carboxamide (PubChem CID 165413669) has the molecular formula C20H17ClF5N7O3S and a molecular weight of 565.91 g/mol. Its IUPAC name is 6-chloro-N-[[3,5-difluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | 6-chloro-N-[[3,5-difluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 165413669 |
| Molecular Formula | C20H17ClF5N7O3S |
| Molecular Weight | 565.91 g/mol |
| Exact Mass | 565.07 |
| IUPAC Name | 6-chloro-N-[[3,5-difluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyrimidine-3-carboxamide |
| SMILES | CCc1nc2ncc(Cl)cn2c1C(=O)NCc1cc(F)c(N2CCN(S(=O)(=O)C(F)(F)F)C=N2)c(F)c1 |
| InChI | InChI=1S/C20H17ClF5N7O3S/c1-2-15-17(32-9-12(21)8-28-19(32)30-15)18(34)27-7-11-5-13(22)16(14(23)6-11)33-4-3-31(10-29-33)37(35,36)20(24,25)26/h5-6,8-10H,2-4,7H2,1H3,(H,27,34) |
| InChIKey | FXQAONKMHWQQIY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.91 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |