C21H18ClF5N6O3S — CID 165413946
5-chloro-N-[[3,5-difluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]-2-ethyl-3aH-pyrrolo[2,3-b]pyridine-3-carboxamide (PubChem CID 165413946) has the molecular formula C21H18ClF5N6O3S and a molecular weight of 564.92 g/mol. Its IUPAC name is 5-chloro-N-[[3,5-difluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]-2-ethyl-3aH-pyrrolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-[[3,5-difluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]-2-ethyl-3aH-pyrrolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 165413946 |
| Molecular Formula | C21H18ClF5N6O3S |
| Molecular Weight | 564.92 g/mol |
| Exact Mass | 564.08 |
| IUPAC Name | 5-chloro-N-[[3,5-difluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]-2-ethyl-3aH-pyrrolo[2,3-b]pyridine-3-carboxamide |
| SMILES | CCC1=C(C(=O)NCc2cc(F)c(N3CCN(S(=O)(=O)C(F)(F)F)C=N3)c(F)c2)C2C=C(Cl)C=NC2=N1 |
| InChI | InChI=1S/C21H18ClF5N6O3S/c1-2-16-17(13-7-12(22)9-28-19(13)31-16)20(34)29-8-11-5-14(23)18(15(24)6-11)33-4-3-32(10-30-33)37(35,36)21(25,26)27/h5-7,9-10,13H,2-4,8H2,1H3,(H,29,34) |
| InChIKey | AEBJJXZLMSCMEU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 106.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.92 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |