C17H23N2O3S2+ — CID 156650251
3-(4-methylsulfonylphenyl)-5-[(1R)-1-(thiolan-2-yl)ethoxy]-2,6-dihydro-1H-pyrazin-4-ium (PubChem CID 156650251) has the molecular formula C17H23N2O3S2+ and a molecular weight of 367.52 g/mol. Its IUPAC name is 3-(4-methylsulfonylphenyl)-5-[(1R)-1-(thiolan-2-yl)ethoxy]-2,6-dihydro-1H-pyrazin-4-ium.
| Compound Name | 3-(4-methylsulfonylphenyl)-5-[(1R)-1-(thiolan-2-yl)ethoxy]-2,6-dihydro-1H-pyrazin-4-ium |
|---|---|
| PubChem CID | 156650251 |
| Molecular Formula | C17H23N2O3S2+ |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 3-(4-methylsulfonylphenyl)-5-[(1R)-1-(thiolan-2-yl)ethoxy]-2,6-dihydro-1H-pyrazin-4-ium |
| SMILES | C[C@@H](OC1=[N+]=C(c2ccc(S(C)(=O)=O)cc2)CNC1)C1CCCS1 |
| InChI | InChI=1S/C17H23N2O3S2/c1-12(16-4-3-9-23-16)22-17-11-18-10-15(19-17)13-5-7-14(8-6-13)24(2,20)21/h5-8,12,16,18H,3-4,9-11H2,1-2H3/q+1/t12-,16?/m1/s1 |
| InChIKey | JJCZFWYLMDQDRC-ZGTOLYCTSA-N |
| XLogP | 1.25 |
| TPSA | 69.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|