C16H19N2O3S2+ — CID 156650232
5-(4-methylsulfonylphenyl)-3-[[(2S)-thiolan-2-yl]methoxy]-2H-pyrazin-4-ium (PubChem CID 156650232) has the molecular formula C16H19N2O3S2+ and a molecular weight of 351.47 g/mol. Its IUPAC name is 5-(4-methylsulfonylphenyl)-3-[[(2S)-thiolan-2-yl]methoxy]-2H-pyrazin-4-ium.
| Compound Name | 5-(4-methylsulfonylphenyl)-3-[[(2S)-thiolan-2-yl]methoxy]-2H-pyrazin-4-ium |
|---|---|
| PubChem CID | 156650232 |
| Molecular Formula | C16H19N2O3S2+ |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 5-(4-methylsulfonylphenyl)-3-[[(2S)-thiolan-2-yl]methoxy]-2H-pyrazin-4-ium |
| SMILES | CS(=O)(=O)c1ccc(C2=[N+]=C(OC[C@@H]3CCCS3)CN=C2)cc1 |
| InChI | InChI=1S/C16H19N2O3S2/c1-23(19,20)14-6-4-12(5-7-14)15-9-17-10-16(18-15)21-11-13-3-2-8-22-13/h4-7,9,13H,2-3,8,10-11H2,1H3/q+1/t13-/m0/s1 |
| InChIKey | WVVGRDLSYNYSIQ-ZDUSSCGKSA-N |
| XLogP | 1.34 |
| TPSA | 69.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|