About 2-[[5-(4-methylsulfonylphenyl)-2H-pyrazin-4-ium-3-yl]oxymethyl]-1,3-thiazolidin-3-ium 3-oxide
2-[[5-(4-methylsulfonylphenyl)-2H-pyrazin-4-ium-3-yl]oxymethyl]-1,3-thiazolidin-3-ium 3-oxide (PubChem CID 156650316) has the molecular formula C15H17N3O4S2+2
and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-[[5-(4-methylsulfonylphenyl)-2H-pyrazin-4-ium-3-yl]oxymethyl]-1,3-thiazolidin-3-ium 3-oxide.
Molecular Properties
| Compound Name | 2-[[5-(4-methylsulfonylphenyl)-2H-pyrazin-4-ium-3-yl]oxymethyl]-1,3-thiazolidin-3-ium 3-oxide |
| PubChem CID | 156650316 |
| Molecular Formula | C15H17N3O4S2+2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 2-[[5-(4-methylsulfonylphenyl)-2H-pyrazin-4-ium-3-yl]oxymethyl]-1,3-thiazolidin-3-ium 3-oxide |
| SMILES | CS(=O)(=O)c1ccc(C2=[N+]=C(OCC3SCC[N+]3=O)CN=C2)cc1 |
| InChI | InChI=1S/C15H17N3O4S2/c1-24(20,21)12-4-2-11(3-5-12)13-8-16-9-14(17-13)22-10-15-18(19)6-7-23-15/h2-5,8,15H,6-7,9-10H2,1H3/q+2 |
| InChIKey | HNWVYLOBISTRKD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 89.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5-(4-methylsulfonylphenyl)-2H-pyrazin-4-ium-3-yl]oxymethyl]-1,3-thiazolidin-3-ium 3-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(4-methylsulfonylphenyl)-2H-pyrazin-4-ium-3-yl]oxymethyl]-1,3-thiazolidin-3-ium 3-oxide?
The IUPAC name of 2-[[5-(4-methylsulfonylphenyl)-2H-pyrazin-4-ium-3-yl]oxymethyl]-1,3-thiazolidin-3-ium 3-oxide (CID 156650316) is 2-[[5-(4-methylsulfonylphenyl)-2H-pyrazin-4-ium-3-yl]oxymethyl]-1,3-thiazolidin-3-ium 3-oxide.
What is the SMILES notation for 2-[[5-(4-methylsulfonylphenyl)-2H-pyrazin-4-ium-3-yl]oxymethyl]-1,3-thiazolidin-3-ium 3-oxide?
The canonical SMILES for 2-[[5-(4-methylsulfonylphenyl)-2H-pyrazin-4-ium-3-yl]oxymethyl]-1,3-thiazolidin-3-ium 3-oxide is CS(=O)(=O)c1ccc(C2=[N+]=C(OCC3SCC[N+]3=O)CN=C2)cc1.
What is the InChIKey of 2-[[5-(4-methylsulfonylphenyl)-2H-pyrazin-4-ium-3-yl]oxymethyl]-1,3-thiazolidin-3-ium 3-oxide?
The InChIKey is HNWVYLOBISTRKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O4S2/c1-24(20,21)12-4-2-11(3-5-12)13-8-16-9-14(17-13)22-10-15-18(19)6-7-23-15/h2-5,8,15H,6-7,9-10H2,1H3/q+2.
What are the key properties of 2-[[5-(4-methylsulfonylphenyl)-2H-pyrazin-4-ium-3-yl]oxymethyl]-1,3-thiazolidin-3-ium 3-oxide?
2-[[5-(4-methylsulfonylphenyl)-2H-pyrazin-4-ium-3-yl]oxymethyl]-1,3-thiazolidin-3-ium 3-oxide has a molecular weight of 367.45 g/mol, XLogP of 0.30, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(4-methylsulfonylphenyl)-2H-pyrazin-4-ium-3-yl]oxymethyl]-1,3-thiazolidin-3-ium 3-oxide is sourced from PubChem (CID 156650316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).