C17H21N2O3S2+ — CID 156650501
3-(4-methylsulfonylphenyl)-5-[(4-methylthiolan-2-yl)methoxy]-2H-pyrazin-4-ium (PubChem CID 156650501) has the molecular formula C17H21N2O3S2+ and a molecular weight of 365.50 g/mol. Its IUPAC name is 3-(4-methylsulfonylphenyl)-5-[(4-methylthiolan-2-yl)methoxy]-2H-pyrazin-4-ium.
| Compound Name | 3-(4-methylsulfonylphenyl)-5-[(4-methylthiolan-2-yl)methoxy]-2H-pyrazin-4-ium |
|---|---|
| PubChem CID | 156650501 |
| Molecular Formula | C17H21N2O3S2+ |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 3-(4-methylsulfonylphenyl)-5-[(4-methylthiolan-2-yl)methoxy]-2H-pyrazin-4-ium |
| SMILES | CC1CSC(COC2=[N+]=C(c3ccc(S(C)(=O)=O)cc3)CN=C2)C1 |
| InChI | InChI=1S/C17H21N2O3S2/c1-12-7-14(23-11-12)10-22-17-9-18-8-16(19-17)13-3-5-15(6-4-13)24(2,20)21/h3-6,9,12,14H,7-8,10-11H2,1-2H3/q+1 |
| InChIKey | RYBZXTZAUCWFOZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 69.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|