C15H26N2O — CID 156651522
N,N-dimethyl-1-[3-(oxan-4-yl)-2-pyridinyl]methanamine;ethane (PubChem CID 156651522) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is N,N-dimethyl-1-[3-(oxan-4-yl)-2-pyridinyl]methanamine;ethane.
| Compound Name | N,N-dimethyl-1-[3-(oxan-4-yl)-2-pyridinyl]methanamine;ethane |
|---|---|
| PubChem CID | 156651522 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | N,N-dimethyl-1-[3-(oxan-4-yl)-2-pyridinyl]methanamine;ethane |
| SMILES | CC.CN(C)Cc1ncccc1C1CCOCC1 |
| InChI | InChI=1S/C13H20N2O.C2H6/c1-15(2)10-13-12(4-3-7-14-13)11-5-8-16-9-6-11;1-2/h3-4,7,11H,5-6,8-10H2,1-2H3;1-2H3 |
| InChIKey | LZRZPMHPXAXBSN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |