C12H22N2Si — CID 13058277
N,N-dimethyl-1-[2-(trimethylsilylmethyl)-3-pyridinyl]methanamine (PubChem CID 13058277) has the molecular formula C12H22N2Si and a molecular weight of 222.41 g/mol. Its IUPAC name is N,N-dimethyl-1-[2-(trimethylsilylmethyl)-3-pyridinyl]methanamine.
| Compound Name | N,N-dimethyl-1-[2-(trimethylsilylmethyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 13058277 |
| Molecular Formula | C12H22N2Si |
| Molecular Weight | 222.41 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | N,N-dimethyl-1-[2-(trimethylsilylmethyl)-3-pyridinyl]methanamine |
| SMILES | CN(C)Cc1cccnc1C[Si](C)(C)C |
| InChI | InChI=1S/C12H22N2Si/c1-14(2)9-11-7-6-8-13-12(11)10-15(3,4)5/h6-8H,9-10H2,1-5H3 |
| InChIKey | LSFKCKYDUFHTRH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|