C13H21N4- — CID 21029903
1-[2-(4-methanidylpiperazin-1-yl)-3-pyridinyl]-N,N-dimethylmethanamine (PubChem CID 21029903) has the molecular formula C13H21N4- and a molecular weight of 233.34 g/mol. Its IUPAC name is 1-[2-(4-methanidylpiperazin-1-yl)-3-pyridinyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2-(4-methanidylpiperazin-1-yl)-3-pyridinyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 21029903 |
| Molecular Formula | C13H21N4- |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 1-[2-(4-methanidylpiperazin-1-yl)-3-pyridinyl]-N,N-dimethylmethanamine |
| SMILES | [CH2-]N1CCN(c2ncccc2CN(C)C)CC1 |
| InChI | InChI=1S/C13H21N4/c1-15(2)11-12-5-4-6-14-13(12)17-9-7-16(3)8-10-17/h4-6H,3,7-11H2,1-2H3/q-1 |
| InChIKey | BNGKEKQJHIJOKA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|