C21H42N2O — CID 156653139
2-(4,4-dimethylpentan-2-ylamino)-1-(4-prop-1-ynylpiperidin-1-yl)ethanone;ethane (PubChem CID 156653139) has the molecular formula C21H42N2O and a molecular weight of 338.58 g/mol. Its IUPAC name is 2-(4,4-dimethylpentan-2-ylamino)-1-(4-prop-1-ynylpiperidin-1-yl)ethanone;ethane.
| Compound Name | 2-(4,4-dimethylpentan-2-ylamino)-1-(4-prop-1-ynylpiperidin-1-yl)ethanone;ethane |
|---|---|
| PubChem CID | 156653139 |
| Molecular Formula | C21H42N2O |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.33 |
| IUPAC Name | 2-(4,4-dimethylpentan-2-ylamino)-1-(4-prop-1-ynylpiperidin-1-yl)ethanone;ethane |
| SMILES | CC.CC.CC#CC1CCN(C(=O)CNC(C)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H30N2O.2C2H6/c1-6-7-15-8-10-19(11-9-15)16(20)13-18-14(2)12-17(3,4)5;2*1-2/h14-15,18H,8-13H2,1-5H3;2*1-2H3 |
| InChIKey | OAQXKSDBSFTMII-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|