C21H38N2O — CID 162766934
1-[4-(3-methylbut-1-ynyl)piperidin-1-yl]-2-(2,3,3,4-tetramethylpentan-2-ylamino)ethanone (PubChem CID 162766934) has the molecular formula C21H38N2O and a molecular weight of 334.55 g/mol. Its IUPAC name is 1-[4-(3-methylbut-1-ynyl)piperidin-1-yl]-2-(2,3,3,4-tetramethylpentan-2-ylamino)ethanone.
| Compound Name | 1-[4-(3-methylbut-1-ynyl)piperidin-1-yl]-2-(2,3,3,4-tetramethylpentan-2-ylamino)ethanone |
|---|---|
| PubChem CID | 162766934 |
| Molecular Formula | C21H38N2O |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.30 |
| IUPAC Name | 1-[4-(3-methylbut-1-ynyl)piperidin-1-yl]-2-(2,3,3,4-tetramethylpentan-2-ylamino)ethanone |
| SMILES | CC(C)C#CC1CCN(C(=O)CNC(C)(C)C(C)(C)C(C)C)CC1 |
| InChI | InChI=1S/C21H38N2O/c1-16(2)9-10-18-11-13-23(14-12-18)19(24)15-22-21(7,8)20(5,6)17(3)4/h16-18,22H,11-15H2,1-8H3 |
| InChIKey | FMRIDLDCNTTYJH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|