C20H18F3N3O2 — CID 156654472
4-[2-methylbut-3-yn-2-yl-[2-[2-(trifluoromethyl)phenyl]acetyl]amino]pyridine-2-carboxamide (PubChem CID 156654472) has the molecular formula C20H18F3N3O2 and a molecular weight of 389.38 g/mol. Its IUPAC name is 4-[2-methylbut-3-yn-2-yl-[2-[2-(trifluoromethyl)phenyl]acetyl]amino]pyridine-2-carboxamide.
| Compound Name | 4-[2-methylbut-3-yn-2-yl-[2-[2-(trifluoromethyl)phenyl]acetyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 156654472 |
| Molecular Formula | C20H18F3N3O2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 4-[2-methylbut-3-yn-2-yl-[2-[2-(trifluoromethyl)phenyl]acetyl]amino]pyridine-2-carboxamide |
| SMILES | C#CC(C)(C)N(C(=O)Cc1ccccc1C(F)(F)F)c1ccnc(C(N)=O)c1 |
| InChI | InChI=1S/C20H18F3N3O2/c1-4-19(2,3)26(14-9-10-25-16(12-14)18(24)28)17(27)11-13-7-5-6-8-15(13)20(21,22)23/h1,5-10,12H,11H2,2-3H3,(H2,24,28) |
| InChIKey | GSHXBBDFVDBJSX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|