C44H35IrN3O2Si-2 — CID 156657001
2-(3H-dibenzofuran-3-id-4-yl)-1-phenylbenzimidazole;iridium;trimethyl-[4-(5-methylfuran-2-yl)-6-phenyl-3-pyridinyl]silane (PubChem CID 156657001) has the molecular formula C44H35IrN3O2Si-2 and a molecular weight of 858.09 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)-1-phenylbenzimidazole;iridium;trimethyl-[4-(5-methylfuran-2-yl)-6-phenyl-3-pyridinyl]silane.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)-1-phenylbenzimidazole;iridium;trimethyl-[4-(5-methylfuran-2-yl)-6-phenyl-3-pyridinyl]silane |
|---|---|
| PubChem CID | 156657001 |
| Molecular Formula | C44H35IrN3O2Si-2 |
| Molecular Weight | 858.09 g/mol |
| Exact Mass | 858.21 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)-1-phenylbenzimidazole;iridium;trimethyl-[4-(5-methylfuran-2-yl)-6-phenyl-3-pyridinyl]silane |
| SMILES | Cc1ccc(-c2cc(-c3[c-]cccc3)ncc2[Si](C)(C)C)o1.[Ir].[c-]1ccc2c(oc3ccccc32)c1-c1nc2ccccc2n1-c1ccccc1 |
| InChI | InChI=1S/C25H15N2O.C19H20NOSi.Ir/c1-2-9-17(10-3-1)27-22-15-6-5-14-21(22)26-25(27)20-13-8-12-19-18-11-4-7-16-23(18)28-24(19)20;1-14-10-11-18(21-14)16-12-17(15-8-6-5-7-9-15)20-13-19(16)22(2,3)4;/h1-12,14-16H;5-8,10-13H,1-4H3;/q2*-1; |
| InChIKey | USWCXKZUURMMAY-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.09 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|