C38H24N2O2 — CID 156657603
1-dibenzofuran-4-yl-2-[1-[4-(trideuteriomethyl)phenyl]dibenzofuran-4-yl]benzimidazole (PubChem CID 156657603) has the molecular formula C38H24N2O2 and a molecular weight of 543.64 g/mol. Its IUPAC name is 1-dibenzofuran-4-yl-2-[1-[4-(trideuteriomethyl)phenyl]dibenzofuran-4-yl]benzimidazole.
| Compound Name | 1-dibenzofuran-4-yl-2-[1-[4-(trideuteriomethyl)phenyl]dibenzofuran-4-yl]benzimidazole |
|---|---|
| PubChem CID | 156657603 |
| Molecular Formula | C38H24N2O2 |
| Molecular Weight | 543.64 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 1-dibenzofuran-4-yl-2-[1-[4-(trideuteriomethyl)phenyl]dibenzofuran-4-yl]benzimidazole |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2ccc(-c3nc4ccccc4n3-c3cccc4c3oc3ccccc34)c3oc4ccccc4c23)cc1 |
| InChI | InChI=1S/C38H24N2O2/c1-23-17-19-24(20-18-23)25-21-22-29(37-35(25)28-10-3-7-16-34(28)42-37)38-39-30-12-4-5-13-31(30)40(38)32-14-8-11-27-26-9-2-6-15-33(26)41-36(27)32/h2-22H,1H3/i1D3 |
| InChIKey | YZZVNOZCWHXDDY-FIBGUPNXSA-N |
| XLogP | 10.47 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.64 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |