C52H39IrN3O2Si-2 — CID 156657602
1-dibenzofuran-4-yl-2-[1-[4-(trideuteriomethyl)phenyl]-3H-dibenzofuran-3-id-4-yl]benzimidazole;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 156657602) has the molecular formula C52H39IrN3O2Si-2 and a molecular weight of 961.22 g/mol. Its IUPAC name is 1-dibenzofuran-4-yl-2-[1-[4-(trideuteriomethyl)phenyl]-3H-dibenzofuran-3-id-4-yl]benzimidazole;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | 1-dibenzofuran-4-yl-2-[1-[4-(trideuteriomethyl)phenyl]-3H-dibenzofuran-3-id-4-yl]benzimidazole;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 156657602 |
| Molecular Formula | C52H39IrN3O2Si-2 |
| Molecular Weight | 961.22 g/mol |
| Exact Mass | 961.26 |
| IUPAC Name | 1-dibenzofuran-4-yl-2-[1-[4-(trideuteriomethyl)phenyl]-3H-dibenzofuran-3-id-4-yl]benzimidazole;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C([2H])([2H])c1ccc(-c2c[c-]c(-c3nc4ccccc4n3-c3cccc4c3oc3ccccc34)c3oc4ccccc4c23)cc1.[Ir] |
| InChI | InChI=1S/C38H23N2O2.C14H16NSi.Ir/c1-23-17-19-24(20-18-23)25-21-22-29(37-35(25)28-10-3-7-16-34(28)42-37)38-39-30-12-4-5-13-31(30)40(38)32-14-8-11-27-26-9-2-6-15-33(26)41-36(27)32;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h2-21H,1H3;4-7,9-11H,1-3H3;/q2*-1;/i1D3;; |
| InChIKey | CUDFXMFVNZYVJY-GXXYEPOPSA-N |
| XLogP | 13.36 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.22 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|