C63H59GeIrN3O-2 — CID 156657879
CID 156657879 (PubChem CID 156657879) has the molecular formula C63H59GeIrN3O-2 and a molecular weight of 1143.04 g/mol.
| Compound Name | CID 156657879 |
|---|---|
| PubChem CID | 156657879 |
| Molecular Formula | C63H59GeIrN3O-2 |
| Molecular Weight | 1143.04 g/mol |
| Exact Mass | 1144.38 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]cc3oc4cc5ccc6ccccc6c5cc4c3c2)nc2ccccc21.[2H]C([2H])([2H])c1c[c-]c(-c2cc(C([2H])(C)C)c([Ge](C)(C)C)cn2)cc1.[Ir] |
| InChI | InChI=1S/C45H35N2O.C18H24GeN.Ir/c1-27(2)35-23-33(29-12-6-5-7-13-29)24-36(28(3)4)44(35)47-41-17-11-10-16-40(41)46-45(47)32-20-21-42-38(22-32)39-26-37-31(25-43(39)48-42)19-18-30-14-8-9-15-34(30)37;1-13(2)16-11-18(15-9-7-14(3)8-10-15)20-12-17(16)19(4,5)6;/h5-19,21-28H,1-4H3;7-9,11-13H,1-6H3;/q2*-1;/i;3D3,13D; |
| InChIKey | TVAMAJCDNLJTKC-JYWWSJRKSA-N |
| XLogP | 17.14 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1143.04 |
| LogP ≤ 5 | 17.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|