C47H38F3IrN3SSi-2 — CID 156658020
iridium;1-naphthalen-2-yl-2-(1,6,8-trifluoro-3H-dibenzothiophen-3-id-4-yl)benzimidazole;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane (PubChem CID 156658020) has the molecular formula C47H38F3IrN3SSi-2 and a molecular weight of 954.21 g/mol. Its IUPAC name is iridium;1-naphthalen-2-yl-2-(1,6,8-trifluoro-3H-dibenzothiophen-3-id-4-yl)benzimidazole;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane.
| Compound Name | iridium;1-naphthalen-2-yl-2-(1,6,8-trifluoro-3H-dibenzothiophen-3-id-4-yl)benzimidazole;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
|---|---|
| PubChem CID | 156658020 |
| Molecular Formula | C47H38F3IrN3SSi-2 |
| Molecular Weight | 954.21 g/mol |
| Exact Mass | 954.21 |
| IUPAC Name | iridium;1-naphthalen-2-yl-2-(1,6,8-trifluoro-3H-dibenzothiophen-3-id-4-yl)benzimidazole;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.Fc1cc(F)c2sc3c(-c4nc5ccccc5n4-c4ccc5ccccc5c4)[c-]cc(F)c3c2c1.[Ir] |
| InChI | InChI=1S/C29H14F3N2S.C18H24NSi.Ir/c30-18-14-21-26-22(31)12-11-20(28(26)35-27(21)23(32)15-18)29-33-24-7-3-4-8-25(24)34(29)19-10-9-16-5-1-2-6-17(16)13-19;1-14(2)11-16-12-17(15-9-7-6-8-10-15)19-13-18(16)20(3,4)5;/h1-10,12-15H;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | CXWFJTUVUCODEV-UHFFFAOYSA-N |
| XLogP | 12.72 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 954.21 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|