C15H21NO4S — CID 15665917
tert-butyl 1,1-dioxo-2-phenyl-1,4-thiazinane-4-carboxylate (PubChem CID 15665917) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is tert-butyl 1,1-dioxo-2-phenyl-1,4-thiazinane-4-carboxylate.
| Compound Name | tert-butyl 1,1-dioxo-2-phenyl-1,4-thiazinane-4-carboxylate |
|---|---|
| PubChem CID | 15665917 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | tert-butyl 1,1-dioxo-2-phenyl-1,4-thiazinane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCS(=O)(=O)C(c2ccccc2)C1 |
| InChI | InChI=1S/C15H21NO4S/c1-15(2,3)20-14(17)16-9-10-21(18,19)13(11-16)12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3 |
| InChIKey | ASTVMNNNHGLBDG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |