C45H44IrN4SSi-2 — CID 156659677
3-[2,6-di(propan-2-yl)phenyl]-2-(8-methyl-3H-dibenzothiophen-3-id-4-yl)imidazo[4,5-c]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 156659677) has the molecular formula C45H44IrN4SSi-2 and a molecular weight of 893.25 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)phenyl]-2-(8-methyl-3H-dibenzothiophen-3-id-4-yl)imidazo[4,5-c]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | 3-[2,6-di(propan-2-yl)phenyl]-2-(8-methyl-3H-dibenzothiophen-3-id-4-yl)imidazo[4,5-c]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 156659677 |
| Molecular Formula | C45H44IrN4SSi-2 |
| Molecular Weight | 893.25 g/mol |
| Exact Mass | 893.27 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)phenyl]-2-(8-methyl-3H-dibenzothiophen-3-id-4-yl)imidazo[4,5-c]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.Cc1ccc2sc3c(-c4nc5ccncc5n4-c4c(C(C)C)cccc4C(C)C)[c-]ccc3c2c1.[Ir] |
| InChI | InChI=1S/C31H28N3S.C14H16NSi.Ir/c1-18(2)21-8-6-9-22(19(3)4)29(21)34-27-17-32-15-14-26(27)33-31(34)24-11-7-10-23-25-16-20(5)12-13-28(25)35-30(23)24;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h6-10,12-19H,1-5H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | AMJCXHXARRBLDG-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.25 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|