C54H49IrN3SSi-2 — CID 156660649
CID 156660649 (PubChem CID 156660649) has the molecular formula C54H49IrN3SSi-2 and a molecular weight of 995.40 g/mol.
| Compound Name | CID 156660649 |
|---|---|
| PubChem CID | 156660649 |
| Molecular Formula | C54H49IrN3SSi-2 |
| Molecular Weight | 995.40 g/mol |
| Exact Mass | 995.32 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(-c2[c-]ccc3c2sc2ccc4c5ccccc5ccc4c23)nc2ccccc21.[2H]C([2H])([2H])c1c[c-]c(-c2ccc([Si](C)(C)C)cn2)cc1.[Ir] |
| InChI | InChI=1S/C39H31N2S.C15H18NSi.Ir/c1-23(2)26-13-9-14-27(24(3)4)37(26)41-34-18-8-7-17-33(34)40-39(41)32-16-10-15-31-36-30-20-19-25-11-5-6-12-28(25)29(30)21-22-35(36)42-38(31)32;1-12-5-7-13(8-6-12)15-10-9-14(11-16-15)17(2,3)4;/h5-15,17-24H,1-4H3;5-7,9-11H,1-4H3;/q2*-1;/i;1D3; |
| InChIKey | YMMULCSRBCUGQQ-ICMJTWPQSA-N |
| XLogP | 14.81 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 995.40 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|