C11H15N2+ — CID 156661009
6-methyl-3-propan-2-yl-7aH-pyrrolo[2,3-c]pyridin-6-ium (PubChem CID 156661009) has the molecular formula C11H15N2+ and a molecular weight of 175.25 g/mol. Its IUPAC name is 6-methyl-3-propan-2-yl-7aH-pyrrolo[2,3-c]pyridin-6-ium.
| Compound Name | 6-methyl-3-propan-2-yl-7aH-pyrrolo[2,3-c]pyridin-6-ium |
|---|---|
| PubChem CID | 156661009 |
| Molecular Formula | C11H15N2+ |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 6-methyl-3-propan-2-yl-7aH-pyrrolo[2,3-c]pyridin-6-ium |
| SMILES | CC(C)C1=C2C=C[N+](C)=CC2N=C1 |
| InChI | InChI=1S/C11H15N2/c1-8(2)10-6-12-11-7-13(3)5-4-9(10)11/h4-8,11H,1-3H3/q+1 |
| InChIKey | SVABIMGDHSMCAJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|