C47H33N3OSi — CID 156661470
2-(5,5-dimethyl-3-phenylbenzo[b][1]benzosilol-1-yl)-4-phenyl-6-(3-phenyldibenzofuran-1-yl)-1,3,5-triazine (PubChem CID 156661470) has the molecular formula C47H33N3OSi and a molecular weight of 683.89 g/mol. Its IUPAC name is 2-(5,5-dimethyl-3-phenylbenzo[b][1]benzosilol-1-yl)-4-phenyl-6-(3-phenyldibenzofuran-1-yl)-1,3,5-triazine.
| Compound Name | 2-(5,5-dimethyl-3-phenylbenzo[b][1]benzosilol-1-yl)-4-phenyl-6-(3-phenyldibenzofuran-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 156661470 |
| Molecular Formula | C47H33N3OSi |
| Molecular Weight | 683.89 g/mol |
| Exact Mass | 683.24 |
| IUPAC Name | 2-(5,5-dimethyl-3-phenylbenzo[b][1]benzosilol-1-yl)-4-phenyl-6-(3-phenyldibenzofuran-1-yl)-1,3,5-triazine |
| SMILES | C[Si]1(C)c2ccccc2-c2c(-c3nc(-c4ccccc4)nc(-c4cc(-c5ccccc5)cc5oc6ccccc6c45)n3)cc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C47H33N3OSi/c1-52(2)41-25-15-13-23-36(41)44-38(27-34(29-42(44)52)31-18-8-4-9-19-31)47-49-45(32-20-10-5-11-21-32)48-46(50-47)37-26-33(30-16-6-3-7-17-30)28-40-43(37)35-22-12-14-24-39(35)51-40/h3-29H,1-2H3 |
| InChIKey | WHXJTRWTOMQPQK-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.89 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|